C24H25BrClN7O4 — CID 6117586
[5-bromo-4-[(Z)-[[4-(3-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-ethoxyphenyl] acetate (PubChem CID 6117586) has the molecular formula C24H25BrClN7O4 and a molecular weight of 590.87 g/mol. Its IUPAC name is [5-bromo-4-[(Z)-[[4-(3-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-ethoxyphenyl] acetate.
| Compound Name | [5-bromo-4-[(Z)-[[4-(3-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6117586 |
| Molecular Formula | C24H25BrClN7O4 |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | [5-bromo-4-[(Z)-[[4-(3-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=N\Nc2nc(Nc3cccc(Cl)c3)nc(N3CCOCC3)n2)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C24H25BrClN7O4/c1-3-36-20-11-16(19(25)13-21(20)37-15(2)34)14-27-32-23-29-22(28-18-6-4-5-17(26)12-18)30-24(31-23)33-7-9-35-10-8-33/h4-6,11-14H,3,7-10H2,1-2H3,(H2,28,29,30,31,32)/b27-14- |
| InChIKey | IABNCSQNTIATCH-VYYCAZPPSA-N |
| XLogP | 4.64 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|