About 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide
4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide (PubChem CID 61176027) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide |
| PubChem CID | 61176027 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide |
| SMILES | Cc1nn(-c2ccc(S(N)(=O)=O)cc2)c(C)c1N |
| InChI | InChI=1S/C11H14N4O2S/c1-7-11(12)8(2)15(14-7)9-3-5-10(6-4-9)18(13,16)17/h3-6H,12H2,1-2H3,(H2,13,16,17) |
| InChIKey | LQOGOOLRQDMFLU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The IUPAC name of 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide (CID 61176027) is 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide.
What is the SMILES notation for 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The canonical SMILES for 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide is Cc1nn(-c2ccc(S(N)(=O)=O)cc2)c(C)c1N.
What is the InChIKey of 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
The InChIKey is LQOGOOLRQDMFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-7-11(12)8(2)15(14-7)9-3-5-10(6-4-9)18(13,16)17/h3-6H,12H2,1-2H3,(H2,13,16,17).
What are the key properties of 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide?
4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide has a molecular weight of 266.33 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3,5-dimethylpyrazol-1-yl)benzenesulfonamide is sourced from PubChem (CID 61176027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).