About 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline
3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline (PubChem CID 61176241) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline.
Molecular Properties
| Compound Name | 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline |
| PubChem CID | 61176241 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline |
| SMILES | Cc1cnc(C)c(-n2ccnc2-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C15H15N5/c1-10-9-18-11(2)14(19-10)20-7-6-17-15(20)12-4-3-5-13(16)8-12/h3-9H,16H2,1-2H3 |
| InChIKey | JOAWALMRBGLUMO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline?
The IUPAC name of 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline (CID 61176241) is 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline.
What is the SMILES notation for 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline?
The canonical SMILES for 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline is Cc1cnc(C)c(-n2ccnc2-c2cccc(N)c2)n1.
What is the InChIKey of 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline?
The InChIKey is JOAWALMRBGLUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5/c1-10-9-18-11(2)14(19-10)20-7-6-17-15(20)12-4-3-5-13(16)8-12/h3-9H,16H2,1-2H3.
What are the key properties of 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline?
3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline has a molecular weight of 265.32 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,6-dimethylpyrazin-2-yl)imidazol-2-yl]aniline is sourced from PubChem (CID 61176241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).