About 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide
2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide (PubChem CID 61176788) has the molecular formula C8H9N5O2S
and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide |
| PubChem CID | 61176788 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide |
| SMILES | Nc1ncn(-c2ccccc2S(N)(=O)=O)n1 |
| InChI | InChI=1S/C8H9N5O2S/c9-8-11-5-13(12-8)6-3-1-2-4-7(6)16(10,14)15/h1-5H,(H2,9,12)(H2,10,14,15) |
| InChIKey | KCEFMLDPQNWPMZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide?
The IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide (CID 61176788) is 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide.
What is the SMILES notation for 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide?
The canonical SMILES for 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide is Nc1ncn(-c2ccccc2S(N)(=O)=O)n1.
What is the InChIKey of 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide?
The InChIKey is KCEFMLDPQNWPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2S/c9-8-11-5-13(12-8)6-3-1-2-4-7(6)16(10,14)15/h1-5H,(H2,9,12)(H2,10,14,15).
What are the key properties of 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide?
2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide has a molecular weight of 239.26 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,2,4-triazol-1-yl)benzenesulfonamide is sourced from PubChem (CID 61176788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).