About 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile
4-(3-amino-1,2,4-triazol-1-yl)benzonitrile (PubChem CID 61176978) has the molecular formula C9H7N5
and a molecular weight of 185.19 g/mol. Its IUPAC name is 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile |
| PubChem CID | 61176978 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2cnc(N)n2)cc1 |
| InChI | InChI=1S/C9H7N5/c10-5-7-1-3-8(4-2-7)14-6-12-9(11)13-14/h1-4,6H,(H2,11,13) |
| InChIKey | NLYLKDLZPSAKAZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile?
The IUPAC name of 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile (CID 61176978) is 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile.
What is the SMILES notation for 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile?
The canonical SMILES for 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile is N#Cc1ccc(-n2cnc(N)n2)cc1.
What is the InChIKey of 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile?
The InChIKey is NLYLKDLZPSAKAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5/c10-5-7-1-3-8(4-2-7)14-6-12-9(11)13-14/h1-4,6H,(H2,11,13).
What are the key properties of 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile?
4-(3-amino-1,2,4-triazol-1-yl)benzonitrile has a molecular weight of 185.19 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-1,2,4-triazol-1-yl)benzonitrile is sourced from PubChem (CID 61176978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).