About 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide
2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide (PubChem CID 61177490) has the molecular formula C13H18N4OS
and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide.
Molecular Properties
| Compound Name | 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide |
| PubChem CID | 61177490 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(NCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C13H18N4OS/c1-7-5-8(2)16-13(11(7)12(14)19)15-6-10(18)17-9-3-4-9/h5,9H,3-4,6H2,1-2H3,(H2,14,19)(H,15,16)(H,17,18) |
| InChIKey | RRRRDQYHLHXAJX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide?
The IUPAC name of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide (CID 61177490) is 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide.
What is the SMILES notation for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide?
The canonical SMILES for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide is Cc1cc(C)c(C(N)=S)c(NCC(=O)NC2CC2)n1.
What is the InChIKey of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide?
The InChIKey is RRRRDQYHLHXAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4OS/c1-7-5-8(2)16-13(11(7)12(14)19)15-6-10(18)17-9-3-4-9/h5,9H,3-4,6H2,1-2H3,(H2,14,19)(H,15,16)(H,17,18).
What are the key properties of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide?
2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide has a molecular weight of 278.38 g/mol, XLogP of 1.02, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-N-cyclopropylacetamide is sourced from PubChem (CID 61177490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).