About 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine
4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine (PubChem CID 61177547) has the molecular formula C7H7BrN4S
and a molecular weight of 259.13 g/mol. Its IUPAC name is 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine |
| PubChem CID | 61177547 |
| Molecular Formula | C7H7BrN4S |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine |
| SMILES | Cc1csc(-n2cc(Br)c(N)n2)n1 |
| InChI | InChI=1S/C7H7BrN4S/c1-4-3-13-7(10-4)12-2-5(8)6(9)11-12/h2-3H,1H3,(H2,9,11) |
| InChIKey | OVGSQGISBBQJSF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine?
The IUPAC name of 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine (CID 61177547) is 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine.
What is the SMILES notation for 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine?
The canonical SMILES for 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine is Cc1csc(-n2cc(Br)c(N)n2)n1.
What is the InChIKey of 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine?
The InChIKey is OVGSQGISBBQJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN4S/c1-4-3-13-7(10-4)12-2-5(8)6(9)11-12/h2-3H,1H3,(H2,9,11).
What are the key properties of 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine?
4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine has a molecular weight of 259.13 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(4-methyl-1,3-thiazol-2-yl)pyrazol-3-amine is sourced from PubChem (CID 61177547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).