About 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine
2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine (PubChem CID 61177776) has the molecular formula C9H15BrN4O2
and a molecular weight of 291.15 g/mol. Its IUPAC name is 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine |
| PubChem CID | 61177776 |
| Molecular Formula | C9H15BrN4O2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1cc(Br)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H15BrN4O2/c1-3-12(4-2)5-6-13-7-8(10)9(11-13)14(15)16/h7H,3-6H2,1-2H3 |
| InChIKey | SOBIWWKVCJYGFE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine?
The IUPAC name of 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine (CID 61177776) is 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine?
The canonical SMILES for 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine is CCN(CC)CCn1cc(Br)c([N+](=O)[O-])n1.
What is the InChIKey of 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine?
The InChIKey is SOBIWWKVCJYGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrN4O2/c1-3-12(4-2)5-6-13-7-8(10)9(11-13)14(15)16/h7H,3-6H2,1-2H3.
What are the key properties of 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine?
2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine has a molecular weight of 291.15 g/mol, XLogP of 1.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-nitropyrazol-1-yl)-N,N-diethylethanamine is sourced from PubChem (CID 61177776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).