C13H19N5O2S — CID 61177812
[1-(4-methylthiadiazole-5-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone (PubChem CID 61177812) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is [1-(4-methylthiadiazole-5-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [1-(4-methylthiadiazole-5-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 61177812 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [1-(4-methylthiadiazole-5-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone |
| SMILES | Cc1nnsc1C(=O)N1CCCC1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C13H19N5O2S/c1-9-11(21-16-15-9)13(20)18-6-2-3-10(18)12(19)17-7-4-14-5-8-17/h10,14H,2-8H2,1H3 |
| InChIKey | UFQRISTVBKGZLP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |