About (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide
(2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 61178289) has the molecular formula C8H10BrN3OS
and a molecular weight of 276.16 g/mol. Its IUPAC name is (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| PubChem CID | 61178289 |
| Molecular Formula | C8H10BrN3OS |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ncc(Br)s1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H10BrN3OS/c9-6-4-11-8(14-6)12-7(13)5-2-1-3-10-5/h4-5,10H,1-3H2,(H,11,12,13)/t5-/m0/s1 |
| InChIKey | FZEXMKPLTOTQKT-YFKPBYRVSA-N |
| XLogP | 1.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (CID 61178289) is (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide is O=C(Nc1ncc(Br)s1)[C@@H]1CCCN1.
What is the InChIKey of (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide?
The InChIKey is FZEXMKPLTOTQKT-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10BrN3OS/c9-6-4-11-8(14-6)12-7(13)5-2-1-3-10-5/h4-5,10H,1-3H2,(H,11,12,13)/t5-/m0/s1.
What are the key properties of (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide?
(2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide has a molecular weight of 276.16 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 61178289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).