C15H23N3O3 — CID 61178634
(2S,3S)-2-amino-N-[2-(3-amino-3-oxopropoxy)phenyl]-3-methylpentanamide (PubChem CID 61178634) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-[2-(3-amino-3-oxopropoxy)phenyl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-amino-N-[2-(3-amino-3-oxopropoxy)phenyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 61178634 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (2S,3S)-2-amino-N-[2-(3-amino-3-oxopropoxy)phenyl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccccc1OCCC(N)=O |
| InChI | InChI=1S/C15H23N3O3/c1-3-10(2)14(17)15(20)18-11-6-4-5-7-12(11)21-9-8-13(16)19/h4-7,10,14H,3,8-9,17H2,1-2H3,(H2,16,19)(H,18,20)/t10-,14-/m0/s1 |
| InChIKey | RWXMPQRABXHCNB-HZMBPMFUSA-N |
| XLogP | 1.25 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |