C12H16F2N2O2 — CID 61178920
(2S)-2-amino-N-[3-(difluoromethoxy)phenyl]-3-methylbutanamide (PubChem CID 61178920) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(difluoromethoxy)phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[3-(difluoromethoxy)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 61178920 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2S)-2-amino-N-[3-(difluoromethoxy)phenyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H16F2N2O2/c1-7(2)10(15)11(17)16-8-4-3-5-9(6-8)18-12(13)14/h3-7,10,12H,15H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | MMFBFHPIABMJAD-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |