C14H17ClN4OS — CID 61179964
(2S)-2-amino-N-(3-chloro-2-pyrazol-1-ylphenyl)-4-methylsulfanylbutanamide (PubChem CID 61179964) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-chloro-2-pyrazol-1-ylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(3-chloro-2-pyrazol-1-ylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61179964 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (2S)-2-amino-N-(3-chloro-2-pyrazol-1-ylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(Cl)c1-n1cccn1 |
| InChI | InChI=1S/C14H17ClN4OS/c1-21-9-6-11(16)14(20)18-12-5-2-4-10(15)13(12)19-8-3-7-17-19/h2-5,7-8,11H,6,9,16H2,1H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | IOGQRDHUPQAQCF-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |