C11H12Cl2N4OS — CID 61180448
(2S)-2-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methylbutanamide (PubChem CID 61180448) has the molecular formula C11H12Cl2N4OS and a molecular weight of 319.22 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 61180448 |
| Molecular Formula | C11H12Cl2N4OS |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2S)-2-amino-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H12Cl2N4OS/c1-4(2)7(14)11(18)15-8-5(12)3-6(13)9-10(8)17-19-16-9/h3-4,7H,14H2,1-2H3,(H,15,18)/t7-/m0/s1 |
| InChIKey | LMQGSGPQAXBEMN-ZETCQYMHSA-N |
| XLogP | 3.64 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |