C12H14N2O6 — CID 61181285
2-[4-hydroxy-N-[(2-methoxy-2-oxoethyl)carbamoyl]anilino]acetic acid (PubChem CID 61181285) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-[4-hydroxy-N-[(2-methoxy-2-oxoethyl)carbamoyl]anilino]acetic acid.
| Compound Name | 2-[4-hydroxy-N-[(2-methoxy-2-oxoethyl)carbamoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 61181285 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[4-hydroxy-N-[(2-methoxy-2-oxoethyl)carbamoyl]anilino]acetic acid |
| SMILES | COC(=O)CNC(=O)N(CC(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H14N2O6/c1-20-11(18)6-13-12(19)14(7-10(16)17)8-2-4-9(15)5-3-8/h2-5,15H,6-7H2,1H3,(H,13,19)(H,16,17) |
| InChIKey | FWBYXUMNEZLHEL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |