C11H15NO4S — CID 611819
4-(2-methylpropylsulfamoyl)benzoic acid (PubChem CID 611819) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-(2-methylpropylsulfamoyl)benzoic acid.
| Compound Name | 4-(2-methylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 611819 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-(2-methylpropylsulfamoyl)benzoic acid |
| SMILES | CC(C)CNS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO4S/c1-8(2)7-12-17(15,16)10-5-3-9(4-6-10)11(13)14/h3-6,8,12H,7H2,1-2H3,(H,13,14) |
| InChIKey | VKGRSBHIZXZUIB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |