C12H11Cl3N2O4 — CID 61182258
4-hydroxy-1-[(2,4,5-trichlorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 61182258) has the molecular formula C12H11Cl3N2O4 and a molecular weight of 353.59 g/mol. Its IUPAC name is 4-hydroxy-1-[(2,4,5-trichlorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-[(2,4,5-trichlorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61182258 |
| Molecular Formula | C12H11Cl3N2O4 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 4-hydroxy-1-[(2,4,5-trichlorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N2O4/c13-6-2-8(15)9(3-7(6)14)16-12(21)17-4-5(18)1-10(17)11(19)20/h2-3,5,10,18H,1,4H2,(H,16,21)(H,19,20) |
| InChIKey | QOLIODZYSVSADE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|