C14H20N2O3 — CID 61183256
(2R)-2-(pentylcarbamoylamino)-2-phenylacetic acid (PubChem CID 61183256) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R)-2-(pentylcarbamoylamino)-2-phenylacetic acid.
| Compound Name | (2R)-2-(pentylcarbamoylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 61183256 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-(pentylcarbamoylamino)-2-phenylacetic acid |
| SMILES | CCCCCNC(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-3-7-10-15-14(19)16-12(13(17)18)11-8-5-4-6-9-11/h4-6,8-9,12H,2-3,7,10H2,1H3,(H,17,18)(H2,15,16,19)/t12-/m1/s1 |
| InChIKey | ZHDIQBKTNRDHLS-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|