C11H13N3O5S2 — CID 61185499
3-[(4-sulfamoylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61185499) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-[(4-sulfamoylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[(4-sulfamoylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61185499 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-[(4-sulfamoylphenyl)carbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)N2CSCC2C(=O)O)cc1 |
| InChI | InChI=1S/C11H13N3O5S2/c12-21(18,19)8-3-1-7(2-4-8)13-11(17)14-6-20-5-9(14)10(15)16/h1-4,9H,5-6H2,(H,13,17)(H,15,16)(H2,12,18,19) |
| InChIKey | UVBYSHGNZNXZEF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |