C11H14N4O3 — CID 61185585
2-cyclopropyl-2-(pyrimidin-2-ylcarbamoylamino)propanoic acid (PubChem CID 61185585) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-cyclopropyl-2-(pyrimidin-2-ylcarbamoylamino)propanoic acid.
| Compound Name | 2-cyclopropyl-2-(pyrimidin-2-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 61185585 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-cyclopropyl-2-(pyrimidin-2-ylcarbamoylamino)propanoic acid |
| SMILES | CC(NC(=O)Nc1ncccn1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C11H14N4O3/c1-11(8(16)17,7-3-4-7)15-10(18)14-9-12-5-2-6-13-9/h2,5-7H,3-4H2,1H3,(H,16,17)(H2,12,13,14,15,18) |
| InChIKey | REKNRAAAOUCPRW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |