C13H15Br3N2O3 — CID 61185874
3,3-dimethyl-2-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid (PubChem CID 61185874) has the molecular formula C13H15Br3N2O3 and a molecular weight of 486.99 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 61185874 |
| Molecular Formula | C13H15Br3N2O3 |
| Molecular Weight | 486.99 g/mol |
| Exact Mass | 483.86 |
| IUPAC Name | 3,3-dimethyl-2-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
| SMILES | CC(C)(C)C(NC(=O)Nc1c(Br)cc(Br)cc1Br)C(=O)O |
| InChI | InChI=1S/C13H15Br3N2O3/c1-13(2,3)10(11(19)20)18-12(21)17-9-7(15)4-6(14)5-8(9)16/h4-5,10H,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | OPLCPQDUPAAXAM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |