C33H46N2O5 — CID 6118785
(4E)-4-[(4-butoxy-3-methylphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6118785) has the molecular formula C33H46N2O5 and a molecular weight of 550.74 g/mol. Its IUPAC name is (4E)-4-[(4-butoxy-3-methylphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-butoxy-3-methylphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6118785 |
| Molecular Formula | C33H46N2O5 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | (4E)-4-[(4-butoxy-3-methylphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccc(OCCCC)c(C)c3)C(=O)C(=O)N2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C33H46N2O5/c1-6-10-12-22-39-27-16-13-25(14-17-27)30-29(32(37)33(38)35(30)20-19-34(8-3)9-4)31(36)26-15-18-28(24(5)23-26)40-21-11-7-2/h13-18,23,30,36H,6-12,19-22H2,1-5H3/b31-29+ |
| InChIKey | LGVCUOMYLAAXOZ-OWWNRXNESA-N |
| XLogP | 6.51 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|