C14H21N3O3 — CID 61187959
4-[[2-(dimethylamino)ethylcarbamoyl-methylamino]methyl]benzoic acid (PubChem CID 61187959) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethylcarbamoyl-methylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(dimethylamino)ethylcarbamoyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 61187959 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[[2-(dimethylamino)ethylcarbamoyl-methylamino]methyl]benzoic acid |
| SMILES | CN(C)CCNC(=O)N(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H21N3O3/c1-16(2)9-8-15-14(20)17(3)10-11-4-6-12(7-5-11)13(18)19/h4-7H,8-10H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | KHLTXJJMTMVPEU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |