C14H14N2O5 — CID 61188088
2-[3-(furan-2-ylmethylcarbamoylamino)phenoxy]acetic acid (PubChem CID 61188088) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethylcarbamoylamino)phenoxy]acetic acid.
| Compound Name | 2-[3-(furan-2-ylmethylcarbamoylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 61188088 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[3-(furan-2-ylmethylcarbamoylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(NC(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C14H14N2O5/c17-13(18)9-21-11-4-1-3-10(7-11)16-14(19)15-8-12-5-2-6-20-12/h1-7H,8-9H2,(H,17,18)(H2,15,16,19) |
| InChIKey | VHBQRMJLWQCIIB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |