C15H21N3O3 — CID 61190065
1-[3-(dimethylamino)propylcarbamoyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 61190065) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propylcarbamoyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-[3-(dimethylamino)propylcarbamoyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61190065 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[3-(dimethylamino)propylcarbamoyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CN(C)CCCNC(=O)N1c2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C15H21N3O3/c1-17(2)9-5-8-16-15(21)18-12-7-4-3-6-11(12)10-13(18)14(19)20/h3-4,6-7,13H,5,8-10H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | VRXIGRHFPRZKAM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|