C12H13BrN2O5 — CID 61190320
(2S)-2-[(3-bromophenyl)carbamoylamino]pentanedioic acid (PubChem CID 61190320) has the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(3-bromophenyl)carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61190320 |
| Molecular Formula | C12H13BrN2O5 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)Nc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C12H13BrN2O5/c13-7-2-1-3-8(6-7)14-12(20)15-9(11(18)19)4-5-10(16)17/h1-3,6,9H,4-5H2,(H,16,17)(H,18,19)(H2,14,15,20)/t9-/m0/s1 |
| InChIKey | CZVROXGNWZROIO-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |