About 9-(dichloromethyl)-3,6-difluoro-9H-fluorene
9-(dichloromethyl)-3,6-difluoro-9H-fluorene (PubChem CID 611907) has the molecular formula C14H8Cl2F2
and a molecular weight of 285.12 g/mol. Its IUPAC name is 9-(dichloromethyl)-3,6-difluoro-9H-fluorene.
Molecular Properties
| Compound Name | 9-(dichloromethyl)-3,6-difluoro-9H-fluorene |
| PubChem CID | 611907 |
| Molecular Formula | C14H8Cl2F2 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 9-(dichloromethyl)-3,6-difluoro-9H-fluorene |
| SMILES | Fc1ccc2c(c1)-c1cc(F)ccc1C2C(Cl)Cl |
| InChI | InChI=1S/C14H8Cl2F2/c15-14(16)13-9-3-1-7(17)5-11(9)12-6-8(18)2-4-10(12)13/h1-6,13-14H |
| InChIKey | ZILSNTAKAOHGEZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-(dichloromethyl)-3,6-difluoro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(dichloromethyl)-3,6-difluoro-9H-fluorene?
The IUPAC name of 9-(dichloromethyl)-3,6-difluoro-9H-fluorene (CID 611907) is 9-(dichloromethyl)-3,6-difluoro-9H-fluorene.
What is the SMILES notation for 9-(dichloromethyl)-3,6-difluoro-9H-fluorene?
The canonical SMILES for 9-(dichloromethyl)-3,6-difluoro-9H-fluorene is Fc1ccc2c(c1)-c1cc(F)ccc1C2C(Cl)Cl.
What is the InChIKey of 9-(dichloromethyl)-3,6-difluoro-9H-fluorene?
The InChIKey is ZILSNTAKAOHGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F2/c15-14(16)13-9-3-1-7(17)5-11(9)12-6-8(18)2-4-10(12)13/h1-6,13-14H.
What are the key properties of 9-(dichloromethyl)-3,6-difluoro-9H-fluorene?
9-(dichloromethyl)-3,6-difluoro-9H-fluorene has a molecular weight of 285.12 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(dichloromethyl)-3,6-difluoro-9H-fluorene is sourced from PubChem (CID 611907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).