4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid

C15H20N2O3 — CID 61191051

IUPAC4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid
SMILESCC1CCCC(C)N1C(=O)Nc1ccc(C(=O)O)cc1
InChIInChI=1S/C15H20N2O3/c1-10-4-3-5-11(2)17(10)15(20)16-13-8-6-12(7-9-13)14(18)19/h6-11H,3-5H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyUCVBJCYHVHCHTK-UHFFFAOYSA-N
MW276.34 g/mol
LogP3.18
Rot. Bonds2

About 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid

4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid (PubChem CID 61191051) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid
PubChem CID61191051
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid
SMILESCC1CCCC(C)N1C(=O)Nc1ccc(C(=O)O)cc1
InChIInChI=1S/C15H20N2O3/c1-10-4-3-5-11(2)17(10)15(20)16-13-8-6-12(7-9-13)14(18)19/h6-11H,3-5H2,1-2H3,(H,16,20)(H,18,19)
InChIKeyUCVBJCYHVHCHTK-UHFFFAOYSA-N
XLogP3.18
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 53.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid?
The IUPAC name of 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid (CID 61191051) is 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid.
What is the SMILES notation for 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid?
The canonical SMILES for 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid is CC1CCCC(C)N1C(=O)Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid?
The InChIKey is UCVBJCYHVHCHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-10-4-3-5-11(2)17(10)15(20)16-13-8-6-12(7-9-13)14(18)19/h6-11H,3-5H2,1-2H3,(H,16,20)(H,18,19).
What are the key properties of 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid?
4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid has a molecular weight of 276.34 g/mol, XLogP of 3.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylpiperidine-1-carbonyl)amino]benzoic acid is sourced from PubChem (CID 61191051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).