2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid

C9H14N4O3S — CID 61192256

IUPAC2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Nc1nncs1
InChIInChI=1S/C9H14N4O3S/c1-3-6(2)13(4-7(14)15)9(16)11-8-12-10-5-17-8/h5-6H,3-4H2,1-2H3,(H,14,15)(H,11,12,16)
InChIKeyWHLMJLBVXVPXJN-UHFFFAOYSA-N
MW258.30 g/mol
LogP1.26
Rot. Bonds5

About 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid

2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid (PubChem CID 61192256) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid.

Molecular Properties

Compound Name2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid
PubChem CID61192256
Molecular FormulaC9H14N4O3S
Molecular Weight258.30 g/mol
Exact Mass258.08
IUPAC Name2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid
SMILESCCC(C)N(CC(=O)O)C(=O)Nc1nncs1
InChIInChI=1S/C9H14N4O3S/c1-3-6(2)13(4-7(14)15)9(16)11-8-12-10-5-17-8/h5-6H,3-4H2,1-2H3,(H,14,15)(H,11,12,16)
InChIKeyWHLMJLBVXVPXJN-UHFFFAOYSA-N
XLogP1.26
TPSA95.42 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.30
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The IUPAC name of 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid (CID 61192256) is 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid.
What is the SMILES notation for 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The canonical SMILES for 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid is CCC(C)N(CC(=O)O)C(=O)Nc1nncs1.
What is the InChIKey of 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
The InChIKey is WHLMJLBVXVPXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O3S/c1-3-6(2)13(4-7(14)15)9(16)11-8-12-10-5-17-8/h5-6H,3-4H2,1-2H3,(H,14,15)(H,11,12,16).
What are the key properties of 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid?
2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid has a molecular weight of 258.30 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butan-2-yl(1,3,4-thiadiazol-2-ylcarbamoyl)amino]acetic acid is sourced from PubChem (CID 61192256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).