3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid

C8H12N4O3S — CID 61192470

IUPAC3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid
SMILESCC(C)C(NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C8H12N4O3S/c1-4(2)5(6(13)14)10-7(15)11-8-12-9-3-16-8/h3-5H,1-2H3,(H,13,14)(H2,10,11,12,15)
InChIKeyUOOCAACFWSTQNR-UHFFFAOYSA-N
MW244.28 g/mol
LogP0.77
Rot. Bonds4

About 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid

3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid (PubChem CID 61192470) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid.

Molecular Properties

Compound Name3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid
PubChem CID61192470
Molecular FormulaC8H12N4O3S
Molecular Weight244.28 g/mol
Exact Mass244.06
IUPAC Name3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid
SMILESCC(C)C(NC(=O)Nc1nncs1)C(=O)O
InChIInChI=1S/C8H12N4O3S/c1-4(2)5(6(13)14)10-7(15)11-8-12-9-3-16-8/h3-5H,1-2H3,(H,13,14)(H2,10,11,12,15)
InChIKeyUOOCAACFWSTQNR-UHFFFAOYSA-N
XLogP0.77
TPSA104.21 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.28
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The IUPAC name of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid (CID 61192470) is 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid.
What is the SMILES notation for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The canonical SMILES for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid is CC(C)C(NC(=O)Nc1nncs1)C(=O)O.
What is the InChIKey of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The InChIKey is UOOCAACFWSTQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3S/c1-4(2)5(6(13)14)10-7(15)11-8-12-9-3-16-8/h3-5H,1-2H3,(H,13,14)(H2,10,11,12,15).
What are the key properties of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid has a molecular weight of 244.28 g/mol, XLogP of 0.77, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid is sourced from PubChem (CID 61192470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).