About 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid
3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid (PubChem CID 61192470) has the molecular formula C8H12N4O3S
and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid.
Molecular Properties
| Compound Name | 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid |
| PubChem CID | 61192470 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid |
| SMILES | CC(C)C(NC(=O)Nc1nncs1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3S/c1-4(2)5(6(13)14)10-7(15)11-8-12-9-3-16-8/h3-5H,1-2H3,(H,13,14)(H2,10,11,12,15) |
| InChIKey | UOOCAACFWSTQNR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The IUPAC name of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid (CID 61192470) is 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid.
What is the SMILES notation for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The canonical SMILES for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid is CC(C)C(NC(=O)Nc1nncs1)C(=O)O.
What is the InChIKey of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
The InChIKey is UOOCAACFWSTQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3S/c1-4(2)5(6(13)14)10-7(15)11-8-12-9-3-16-8/h3-5H,1-2H3,(H,13,14)(H2,10,11,12,15).
What are the key properties of 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid?
3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid has a molecular weight of 244.28 g/mol, XLogP of 0.77, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1,3,4-thiadiazol-2-ylcarbamoylamino)butanoic acid is sourced from PubChem (CID 61192470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).