About 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile
3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile (PubChem CID 61192885) has the molecular formula C12H19N3S
and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile.
Molecular Properties
| Compound Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile |
| PubChem CID | 61192885 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile |
| SMILES | CCC(CC#N)NC(C)c1sc(C)nc1C |
| InChI | InChI=1S/C12H19N3S/c1-5-11(6-7-13)15-9(3)12-8(2)14-10(4)16-12/h9,11,15H,5-6H2,1-4H3 |
| InChIKey | XGVPNLJPLXHLRY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile?
The IUPAC name of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile (CID 61192885) is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile.
What is the SMILES notation for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile?
The canonical SMILES for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile is CCC(CC#N)NC(C)c1sc(C)nc1C.
What is the InChIKey of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile?
The InChIKey is XGVPNLJPLXHLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3S/c1-5-11(6-7-13)15-9(3)12-8(2)14-10(4)16-12/h9,11,15H,5-6H2,1-4H3.
What are the key properties of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile?
3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile has a molecular weight of 237.37 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanenitrile is sourced from PubChem (CID 61192885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).