3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid

C11H18N2O2S — CID 61193232

IUPAC3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid
SMILESCc1nc(C)c(C(C)NC(C)CC(=O)O)s1
InChIInChI=1S/C11H18N2O2S/c1-6(5-10(14)15)12-7(2)11-8(3)13-9(4)16-11/h6-7,12H,5H2,1-4H3,(H,14,15)
InChIKeyCSTMMMZFRHJTIT-UHFFFAOYSA-N
MW242.34 g/mol
LogP2.27
Rot. Bonds5

About 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid

3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid (PubChem CID 61193232) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid.

Molecular Properties

Compound Name3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid
PubChem CID61193232
Molecular FormulaC11H18N2O2S
Molecular Weight242.34 g/mol
Exact Mass242.11
IUPAC Name3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid
SMILESCc1nc(C)c(C(C)NC(C)CC(=O)O)s1
InChIInChI=1S/C11H18N2O2S/c1-6(5-10(14)15)12-7(2)11-8(3)13-9(4)16-11/h6-7,12H,5H2,1-4H3,(H,14,15)
InChIKeyCSTMMMZFRHJTIT-UHFFFAOYSA-N
XLogP2.27
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.34
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid?
The IUPAC name of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid (CID 61193232) is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid.
What is the SMILES notation for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid?
The canonical SMILES for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid is Cc1nc(C)c(C(C)NC(C)CC(=O)O)s1.
What is the InChIKey of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid?
The InChIKey is CSTMMMZFRHJTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-6(5-10(14)15)12-7(2)11-8(3)13-9(4)16-11/h6-7,12H,5H2,1-4H3,(H,14,15).
What are the key properties of 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid?
3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid has a molecular weight of 242.34 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]butanoic acid is sourced from PubChem (CID 61193232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).