C26H18ClIN2O4S — CID 6119648
(4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione (PubChem CID 6119648) has the molecular formula C26H18ClIN2O4S and a molecular weight of 616.86 g/mol. Its IUPAC name is (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6119648 |
| Molecular Formula | C26H18ClIN2O4S |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 615.97 |
| IUPAC Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-5-(4-iodophenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(Cl)cc4s3)C2c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C26H18ClIN2O4S/c1-2-34-18-10-5-15(6-11-18)23(31)21-22(14-3-8-17(28)9-4-14)30(25(33)24(21)32)26-29-19-12-7-16(27)13-20(19)35-26/h3-13,22,31H,2H2,1H3/b23-21+ |
| InChIKey | HPIHNRUDMJTGBQ-XTQSDGFTSA-N |
| XLogP | 6.58 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|