C15H16N2O4 — CID 61197373
3-[1-(furan-2-yl)ethylcarbamoylamino]-4-methylbenzoic acid (PubChem CID 61197373) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)ethylcarbamoylamino]-4-methylbenzoic acid.
| Compound Name | 3-[1-(furan-2-yl)ethylcarbamoylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 61197373 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[1-(furan-2-yl)ethylcarbamoylamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)NC(C)c1ccco1 |
| InChI | InChI=1S/C15H16N2O4/c1-9-5-6-11(14(18)19)8-12(9)17-15(20)16-10(2)13-4-3-7-21-13/h3-8,10H,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | YQMRPXAVUNPDPT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |