C13H21N3O4 — CID 61197997
1-[[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 61197997) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61197997 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CNC(=O)CNC(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C13H21N3O4/c1-14-11(17)7-15-13(20)16-9-5-3-2-4-8(9)6-10(16)12(18)19/h8-10H,2-7H2,1H3,(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | SKWMARPYMRWZGL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |