C10H16N4O3 — CID 61198130
2-[(1-methylpyrazol-4-yl)carbamoylamino]pentanoic acid (PubChem CID 61198130) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-4-yl)carbamoylamino]pentanoic acid.
| Compound Name | 2-[(1-methylpyrazol-4-yl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 61198130 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[(1-methylpyrazol-4-yl)carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)Nc1cnn(C)c1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c1-3-4-8(9(15)16)13-10(17)12-7-5-11-14(2)6-7/h5-6,8H,3-4H2,1-2H3,(H,15,16)(H2,12,13,17) |
| InChIKey | YPQXHXPOXMIBTB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |