C14H23N3O4 — CID 61198430
1-[methyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 61198430) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[methyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[methyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61198430 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[methyl-[2-(methylamino)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CNC(=O)CN(C)C(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C14H23N3O4/c1-15-12(18)8-16(2)14(21)17-10-6-4-3-5-9(10)7-11(17)13(19)20/h9-11H,3-8H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | KCVPZTXLQDEPLP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |