C12H22N2O5S — CID 61201466
2-[(1,1-dioxothian-4-yl)carbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 61201466) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61201466 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)carbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(NC(=O)NC1CCS(=O)(=O)CC1)C(=O)O |
| InChI | InChI=1S/C12H22N2O5S/c1-12(2,3)9(10(15)16)14-11(17)13-8-4-6-20(18,19)7-5-8/h8-9H,4-7H2,1-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | NUGHHVZWEUGJGX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |