4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid

C13H14N4O3 — CID 61202247

IUPAC4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid
SMILESCc1n[nH]c(C)c1NC(=O)Nc1ccc(C(=O)O)cc1
InChIInChI=1S/C13H14N4O3/c1-7-11(8(2)17-16-7)15-13(20)14-10-5-3-9(4-6-10)12(18)19/h3-6H,1-2H3,(H,16,17)(H,18,19)(H2,14,15,20)
InChIKeyDRDLBNLRJZKMTQ-UHFFFAOYSA-N
MW274.28 g/mol
LogP2.37
Rot. Bonds3

About 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid

4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid (PubChem CID 61202247) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid.

Molecular Properties

Compound Name4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid
PubChem CID61202247
Molecular FormulaC13H14N4O3
Molecular Weight274.28 g/mol
Exact Mass274.11
IUPAC Name4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid
SMILESCc1n[nH]c(C)c1NC(=O)Nc1ccc(C(=O)O)cc1
InChIInChI=1S/C13H14N4O3/c1-7-11(8(2)17-16-7)15-13(20)14-10-5-3-9(4-6-10)12(18)19/h3-6H,1-2H3,(H,16,17)(H,18,19)(H2,14,15,20)
InChIKeyDRDLBNLRJZKMTQ-UHFFFAOYSA-N
XLogP2.37
TPSA107.11 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 52.37
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid?
The IUPAC name of 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid (CID 61202247) is 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid.
What is the SMILES notation for 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid?
The canonical SMILES for 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid is Cc1n[nH]c(C)c1NC(=O)Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid?
The InChIKey is DRDLBNLRJZKMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c1-7-11(8(2)17-16-7)15-13(20)14-10-5-3-9(4-6-10)12(18)19/h3-6H,1-2H3,(H,16,17)(H,18,19)(H2,14,15,20).
What are the key properties of 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid?
4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid has a molecular weight of 274.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoylamino]benzoic acid is sourced from PubChem (CID 61202247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).