About 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid
3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid (PubChem CID 61202435) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid |
| PubChem CID | 61202435 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)Nc1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H18N4O3/c1-4-15(6-5-9(16)17)11(18)12-10-7(2)13-14-8(10)3/h4-6H2,1-3H3,(H,12,18)(H,13,14)(H,16,17) |
| InChIKey | DOECHXHALLDOTR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid?
The IUPAC name of 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid (CID 61202435) is 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid.
What is the SMILES notation for 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid?
The canonical SMILES for 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid is CCN(CCC(=O)O)C(=O)Nc1c(C)n[nH]c1C.
What is the InChIKey of 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid?
The InChIKey is DOECHXHALLDOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-4-15(6-5-9(16)17)11(18)12-10-7(2)13-14-8(10)3/h4-6H2,1-3H3,(H,12,18)(H,13,14)(H,16,17).
What are the key properties of 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid?
3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid has a molecular weight of 254.29 g/mol, XLogP of 1.36, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-1H-pyrazol-4-yl)carbamoyl-ethylamino]propanoic acid is sourced from PubChem (CID 61202435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).