C8H13F3N2O3 — CID 61206244
3-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]butanoic acid (PubChem CID 61206244) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 3-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 3-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 61206244 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[[methyl(2,2,2-trifluoroethyl)carbamoyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3/c1-5(3-6(14)15)12-7(16)13(2)4-8(9,10)11/h5H,3-4H2,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | TWNMMTWIKKCBCS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |