About 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid
3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 61206682) has the molecular formula C13H13NO4S3
and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid |
| PubChem CID | 61206682 |
| Molecular Formula | C13H13NO4S3 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1S(=O)(=O)NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C13H13NO4S3/c15-13(16)12-11(4-5-19-12)21(17,18)14-7-9-6-8-2-1-3-10(8)20-9/h4-6,14H,1-3,7H2,(H,15,16) |
| InChIKey | APJKKMIPYFIKGF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The IUPAC name of 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid (CID 61206682) is 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The canonical SMILES for 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid is O=C(O)c1sccc1S(=O)(=O)NCc1cc2c(s1)CCC2.
What is the InChIKey of 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The InChIKey is APJKKMIPYFIKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S3/c15-13(16)12-11(4-5-19-12)21(17,18)14-7-9-6-8-2-1-3-10(8)20-9/h4-6,14H,1-3,7H2,(H,15,16).
What are the key properties of 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid has a molecular weight of 343.45 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 61206682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).