About 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide
3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide (PubChem CID 61207389) has the molecular formula C15H18N2O2S2
and a molecular weight of 322.46 g/mol. Its IUPAC name is 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide |
| PubChem CID | 61207389 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)NCc2cc3c(s2)CCC3)c1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-10-5-12(16)8-14(6-10)21(18,19)17-9-13-7-11-3-2-4-15(11)20-13/h5-8,17H,2-4,9,16H2,1H3 |
| InChIKey | MCBSNTZAFJTUET-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide?
The IUPAC name of 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide (CID 61207389) is 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide.
What is the SMILES notation for 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide?
The canonical SMILES for 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide is Cc1cc(N)cc(S(=O)(=O)NCc2cc3c(s2)CCC3)c1.
What is the InChIKey of 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide?
The InChIKey is MCBSNTZAFJTUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S2/c1-10-5-12(16)8-14(6-10)21(18,19)17-9-13-7-11-3-2-4-15(11)20-13/h5-8,17H,2-4,9,16H2,1H3.
What are the key properties of 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide?
3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide has a molecular weight of 322.46 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-5-methylbenzenesulfonamide is sourced from PubChem (CID 61207389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).