C12H22N2O3 — CID 61208618
3-[(2-methylpyrrolidine-1-carbonyl)-propan-2-ylamino]propanoic acid (PubChem CID 61208618) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[(2-methylpyrrolidine-1-carbonyl)-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[(2-methylpyrrolidine-1-carbonyl)-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 61208618 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-[(2-methylpyrrolidine-1-carbonyl)-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)N1CCCC1C |
| InChI | InChI=1S/C12H22N2O3/c1-9(2)13(8-6-11(15)16)12(17)14-7-4-5-10(14)3/h9-10H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | AKYVHJAOTBNPEM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |