C29H27NO5 — CID 6120962
(4E)-4-[hydroxy(phenyl)methylidene]-1-(oxolan-2-ylmethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6120962) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (4E)-4-[hydroxy(phenyl)methylidene]-1-(oxolan-2-ylmethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(phenyl)methylidene]-1-(oxolan-2-ylmethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6120962 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (4E)-4-[hydroxy(phenyl)methylidene]-1-(oxolan-2-ylmethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CC2CCCO2)C(c2ccc(OCc3ccccc3)cc2)/C1=C(\O)c1ccccc1 |
| InChI | InChI=1S/C29H27NO5/c31-27(22-10-5-2-6-11-22)25-26(30(29(33)28(25)32)18-24-12-7-17-34-24)21-13-15-23(16-14-21)35-19-20-8-3-1-4-9-20/h1-6,8-11,13-16,24,26,31H,7,12,17-19H2/b27-25+ |
| InChIKey | OZZILJMAFVWPQF-IMVLJIQESA-N |
| XLogP | 4.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|