C11H20N4 — CID 61210854
1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-3-amine (PubChem CID 61210854) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-3-amine.
| Compound Name | 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 61210854 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-3-amine |
| SMILES | Cc1[nH]ncc1CNC1CCCN(C)C1 |
| InChI | InChI=1S/C11H20N4/c1-9-10(7-13-14-9)6-12-11-4-3-5-15(2)8-11/h7,11-12H,3-6,8H2,1-2H3,(H,13,14) |
| InChIKey | VEBBYJBCFWSKSU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |