C11H12BrN3OS — CID 61211107
5-bromo-N-[2-(1-methylimidazol-2-yl)ethyl]thiophene-3-carboxamide (PubChem CID 61211107) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 5-bromo-N-[2-(1-methylimidazol-2-yl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(1-methylimidazol-2-yl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 61211107 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-bromo-N-[2-(1-methylimidazol-2-yl)ethyl]thiophene-3-carboxamide |
| SMILES | Cn1ccnc1CCNC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C11H12BrN3OS/c1-15-5-4-13-10(15)2-3-14-11(16)8-6-9(12)17-7-8/h4-7H,2-3H2,1H3,(H,14,16) |
| InChIKey | IYSBBPXCPLMSKL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |