C12H12N2O4 — CID 61211147
3-(1,3-benzodioxol-4-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 61211147) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-4-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61211147 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(1,3-benzodioxol-4-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2cccc3c2OCO3)C(=O)N1 |
| InChI | InChI=1S/C12H12N2O4/c15-10-4-8(12(16)14-10)13-5-7-2-1-3-9-11(7)18-6-17-9/h1-3,8,13H,4-6H2,(H,14,15,16) |
| InChIKey | MUQMBTLNKBADNE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|