C16H33N3O — CID 61211177
N,N,3-trimethyl-1-[(2-morpholin-4-ylethylamino)methyl]cyclohexan-1-amine (PubChem CID 61211177) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is N,N,3-trimethyl-1-[(2-morpholin-4-ylethylamino)methyl]cyclohexan-1-amine.
| Compound Name | N,N,3-trimethyl-1-[(2-morpholin-4-ylethylamino)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 61211177 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | N,N,3-trimethyl-1-[(2-morpholin-4-ylethylamino)methyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(CNCCN2CCOCC2)(N(C)C)C1 |
| InChI | InChI=1S/C16H33N3O/c1-15-5-4-6-16(13-15,18(2)3)14-17-7-8-19-9-11-20-12-10-19/h15,17H,4-14H2,1-3H3 |
| InChIKey | YBPGKBVYMUXPGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|