C17H21NO2 — CID 612113
3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione (PubChem CID 612113) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 612113 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)c2cc3c(nc2C1)CC(C)(C)CC3=O |
| InChI | InChI=1S/C17H21NO2/c1-16(2)6-12-10(14(19)8-16)5-11-13(18-12)7-17(3,4)9-15(11)20/h5H,6-9H2,1-4H3 |
| InChIKey | PMQGCFXOTZQZRF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |